Difference between revisions of "PWY-7663"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-glutamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hjcmdxdypoufdy-whfbiakzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 217.224 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6976]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-glutamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hjcmdxdypoufdy-whfbiakzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.224}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-13403
- common-name:
- l-alanyl-l-glutamine
- smiles:
- cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n
- inchi-key:
- hjcmdxdypoufdy-whfbiakzsa-n
- molecular-weight:
- 217.224
