Difference between revisions of "PWY-7663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRULOSE D-ERYTHRULOSE] == * common-name: ** d-erythrulose * smiles: ** c(o)c(o)c(=o)co *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRULOSE D-ERYTHRULOSE] ==
 
* common-name:
 
* common-name:
** l-alanyl-l-glutamine
+
** d-erythrulose
 
* smiles:
 
* smiles:
** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n
+
** c(o)c(o)c(=o)co
 
* inchi-key:
 
* inchi-key:
** hjcmdxdypoufdy-whfbiakzsa-n
+
** uqphvqvxlprncx-gsvougtgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 217.224
+
** 120.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6976]]
+
* [[ERYTHRULOSE-REDUCTASE-RXN]]
 +
* [[RXN-17773]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ERYTHRULOSE-REDUCTASE-RXN]]
 +
* [[RXN-17773]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-l-glutamine}}
+
{{#set: common-name=d-erythrulose}}
{{#set: inchi-key=inchikey=hjcmdxdypoufdy-whfbiakzsa-n}}
+
{{#set: inchi-key=inchikey=uqphvqvxlprncx-gsvougtgsa-n}}
{{#set: molecular-weight=217.224}}
+
{{#set: molecular-weight=120.105}}

Revision as of 09:22, 27 August 2019

Metabolite D-ERYTHRULOSE

  • common-name:
    • d-erythrulose
  • smiles:
    • c(o)c(o)c(=o)co
  • inchi-key:
    • uqphvqvxlprncx-gsvougtgsa-n
  • molecular-weight:
    • 120.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality