Difference between revisions of "PWY-7686"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(...")
(Created page with "Category:pathway == Pathway PWY-3722 == * taxonomic-range: ** tax-1239 * common-name: ** glycine betaine biosynthesis ii (gram-positive bacteria) == Reaction(s) found == *...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] ==
+
== Pathway PWY-3722 ==
 +
* taxonomic-range:
 +
** tax-1239
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** glycine betaine biosynthesis ii (gram-positive bacteria)
* smiles:
+
== Reaction(s) found ==
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
+
* [[BADH-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** yppfejhohnpklt-pbsuhmdjsa-s
+
* [NoneRXN-6021 RXN-6021]
* molecular-weight:
+
{{#set: taxonomic-range=tax-1239}}
** 515.583
+
{{#set: common-name=glycine betaine biosynthesis ii (gram-positive bacteria)}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.5}}
* [[RXN-13168]]
+
{{#set: nb total reaction=2}}
* [[RXN-15284]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=nebramycin 5'}}
 
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
 
{{#set: molecular-weight=515.583}}
 

Revision as of 20:16, 18 December 2020

Pathway PWY-3722

  • taxonomic-range:
    • tax-1239
  • common-name:
    • glycine betaine biosynthesis ii (gram-positive bacteria)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-6021 RXN-6021]