Difference between revisions of "PWY-7693"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] == * common-name: ** oxalate * smiles: ** c([o-])(c(=o)[o-])=o * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] ==
 
* common-name:
 
* common-name:
** oxalate
+
** 18-hydroxylinoleoyl-coa
 
* smiles:
 
* smiles:
** c([o-])(c(=o)[o-])=o
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mubzpkhoepujkr-uhfffaoysa-l
+
** hjegylshikpenr-daxvlclxsa-j
 
* molecular-weight:
 
* molecular-weight:
** 88.02
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OXALATE-DECARBOXYLASE-RXN]]
+
* [[RXN-16118]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYOXYLATE-OXIDASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxalate}}
+
{{#set: common-name=18-hydroxylinoleoyl-coa}}
{{#set: inchi-key=inchikey=mubzpkhoepujkr-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
{{#set: molecular-weight=88.02}}
+
{{#set: molecular-weight=1041.936}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-17371

  • common-name:
    • 18-hydroxylinoleoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hjegylshikpenr-daxvlclxsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality