Difference between revisions of "PWY-7701"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(...")
(Created page with "Category:pathway == Pathway PWY-7701 == * taxonomic-range: ** tax-33090 ** tax-4751 * common-name: ** 4-hydroxy-4-methyl-l-glutamate biosynthesis == Reaction(s) found == *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
+
== Pathway PWY-7701 ==
 +
* taxonomic-range:
 +
** tax-33090
 +
** tax-4751
 
* common-name:
 
* common-name:
** quinoxaline-2-carboxyl adenylate
+
** 4-hydroxy-4-methyl-l-glutamate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
+
* [[4.1.3.17-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** vmjweicpcdrxql-scfuhwhpsa-m
+
* [NoneRXN-16958 RXN-16958]
* molecular-weight:
+
{{#set: taxonomic-range=tax-4751|tax-33090}}
** 502.359
+
{{#set: common-name=4-hydroxy-4-methyl-l-glutamate biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-17155]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=quinoxaline-2-carboxyl adenylate}}
 
{{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
 
{{#set: molecular-weight=502.359}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7701

  • taxonomic-range:
    • tax-33090
    • tax-4751
  • common-name:
    • 4-hydroxy-4-methyl-l-glutamate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16958 RXN-16958]