Difference between revisions of "PWY-7701"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * common-name: ** 3-sulfinopyruvate * smiles: ** c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
 
* common-name:
 
* common-name:
** 3-sulfinopyruvate
+
** quinoxaline-2-carboxyl adenylate
 
* smiles:
 
* smiles:
** c(s([o-])=o)c(=o)c(=o)[o-]
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
 
* inchi-key:
 
* inchi-key:
** jxylqemxcaamol-uhfffaoysa-l
+
** vmjweicpcdrxql-scfuhwhpsa-m
 
* molecular-weight:
 
* molecular-weight:
** 150.106
+
** 502.359
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-17155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-sulfinopyruvate}}
+
{{#set: common-name=quinoxaline-2-carboxyl adenylate}}
{{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
{{#set: molecular-weight=150.106}}
+
{{#set: molecular-weight=502.359}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-18550

  • common-name:
    • quinoxaline-2-carboxyl adenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
  • inchi-key:
    • vmjweicpcdrxql-scfuhwhpsa-m
  • molecular-weight:
    • 502.359

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality