Difference between revisions of "PWY-7701"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * common-name: ** 3-sulfinopyruvate * smiles: ** c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == |
* common-name: | * common-name: | ||
− | ** | + | ** quinoxaline-2-carboxyl adenylate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vmjweicpcdrxql-scfuhwhpsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 502.359 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17155]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=quinoxaline-2-carboxyl adenylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=502.359}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-18550
- common-name:
- quinoxaline-2-carboxyl adenylate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
- inchi-key:
- vmjweicpcdrxql-scfuhwhpsa-m
- molecular-weight:
- 502.359