Difference between revisions of "PWY-7718"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLIN SCOPOLIN] ==
+== Pathway PWY-5826 ==
+* taxonomic-range:
+** tax-3193
 * common-name:
-** scopolin
+** hypoglycin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c(c(c(o)c(co)o3)o)o)))
+* [[RXN-15122]]
-* inchi-key:
+* [[RXN-9157]]
-** sgtcgccqzoumjj-ymiltqatsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-15121 RXN-15121]
-** 354.313
+* [NoneRXN-9173 RXN-9173]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-15123 RXN-15123]
-* [[RXN-14179]]
+* [NoneRXN-9167 RXN-9167]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-9171 RXN-9171]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-9172 RXN-9172]
-{{#set: common-name=scopolin}}
+* [NoneRXN-9189 RXN-9189]
-{{#set: inchi-key=inchikey=sgtcgccqzoumjj-ymiltqatsa-n}}
+* [NoneRXN-9170 RXN-9170]
-{{#set: molecular-weight=354.313}}
+* [NoneRXN-9169 RXN-9169]
+* [NoneRXN-9174 RXN-9174]
+* [NoneRXN-9175 RXN-9175]
+* [NoneRXN-9168 RXN-9168]
+{{#set: taxonomic-range=tax-3193}}
+{{#set: common-name=hypoglycin biosynthesis}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.14}}
+{{#set: nb total reaction=14}}