Difference between revisions of "PWY-7721"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-365 CPD-365] ==
+== Pathway PWY-7721 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** 1-keto-d-chiro-inositol
+** methyl phomopsenoate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* inchi-key:
+* [[FPPSYN-RXN]]
-** vyegbdhsghxogt-qfycrykcsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-17086 RXN-17086]
-** 178.141
+* [NoneRXN-17085 RXN-17085]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-4751}}
-* [[RXN-14148]]
+{{#set: common-name=methyl phomopsenoate biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-14148]]
+{{#set: completion rate=0.5}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=1-keto-d-chiro-inositol}}
-{{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}}
-{{#set: molecular-weight=178.141}}