Difference between revisions of "PWY-7723"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+== Pathway PWY-7723 ==
+* taxonomic-range:
+** tax-267890
+** tax-543
+** tax-641
 * common-name:
-** 1d-myo-inositol 5-monophosphate
+** bacterial bioluminescence
-* smiles:
+== Reaction(s) found ==
-** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
+* [[RXN-16395]]
-* inchi-key:
+* [[RXN-9510]]
-** inapmgsxuvuwaf-kxxvrosksa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-17107 RXN-17107]
-** 258.121
+* [NoneFMNREDUCT-RXN FMNREDUCT-RXN]
-== Reaction(s) known to consume the compound ==
+* [None6.2.1.19-RXN 6.2.1.19-RXN]
-* [[RXN-10953]]
+* [NoneALKANAL-MONOOXYGENASE-FMN-LINKED-RXN ALKANAL-MONOOXYGENASE-FMN-LINKED-RXN]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17108 RXN-17108]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-12444 RXN-12444]
-{{#set: common-name=1d-myo-inositol 5-monophosphate}}
+{{#set: taxonomic-range=tax-543|tax-267890|tax-641}}
-{{#set: inchi-key=inchikey=inapmgsxuvuwaf-kxxvrosksa-l}}
+{{#set: common-name=bacterial bioluminescence}}
-{{#set: molecular-weight=258.121}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.25}}
+{{#set: nb total reaction=8}}