Difference between revisions of "PWY-7723"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROPEROXYOCTADECA-911-DIENOATE 13-HYDROPEROXYOCTADECA-911-DIENOATE] ==
+== Pathway PWY-5532 ==
+* taxonomic-range:
+** tax-2157
 * common-name:
-** (13s)-hpode
+** nucleoside and nucleotide degradation (archaea)
-* smiles:
+== Reaction(s) found ==
-** cccccc(c=cc=ccccccccc(=o)[o-])oo
+* [[ADENPHOSPHOR-RXN]]
-* inchi-key:
+* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
-** jdsrhvwsamtssn-irqzeampsa-m
+* [[RXN0-5199]]
-* molecular-weight:
+* [[URPHOS-RXN]]
-** 311.44
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8801 RXN-8801]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17337 RXN-17337]
-* [[LIPOXYGENASE-RXN]]
+* [NoneCYTIKIN-RXN CYTIKIN-RXN]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-14699 RXN-14699]
-{{#set: common-name=(13s)-hpode}}
+* [NoneRXN-8800 RXN-8800]
-{{#set: inchi-key=inchikey=jdsrhvwsamtssn-irqzeampsa-m}}
+* [NoneRXN-14700 RXN-14700]
-{{#set: molecular-weight=311.44}}
+{{#set: taxonomic-range=tax-2157}}
+{{#set: common-name=nucleoside and nucleotide degradation (archaea)}}
+{{#set: nb reaction found=4}}
+{{#set: completion rate=0.4}}
+{{#set: nb total reaction=10}}