Difference between revisions of "PWY-7725"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Spliced-tRNA-precursor Spliced-tRNA-precursor] == * common-name: ** a spliced trna == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Spliced-tRNA-precursor Spliced-tRNA-precursor] ==
 
* common-name:
 
* common-name:
** dcdp
+
** a spliced trna
* smiles:
 
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o
 
* inchi-key:
 
** ftdhdkpuhblbtl-shyzeuofsa-k
 
* molecular-weight:
 
** 384.155
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDCD]]
 
* [[ATDCDm]]
 
* [[DCDPKIN-RXN]]
 
* [[DCTPtm]]
 
* [[RXN-14187]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDCM]]
+
* [[2.7.1.160-RXN]]
* [[CDPREDUCT-RXN]]
 
* [[DCDT]]
 
* [[DCTCP]]
 
* [[DCTPtm]]
 
* [[DCTUP]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 
* [[RXN-14216]]
 
* [[RXN-7913]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dcdp}}
+
{{#set: common-name=a spliced trna}}
{{#set: inchi-key=inchikey=ftdhdkpuhblbtl-shyzeuofsa-k}}
 
{{#set: molecular-weight=384.155}}
 

Revision as of 09:22, 27 August 2019

Metabolite Spliced-tRNA-precursor

  • common-name:
    • a spliced trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality