Difference between revisions of "PWY-7733"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] ==
+== Pathway PWY-7733 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** phylloquinone
+** 3-hydroxyquinaldate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
+* [[RXN-17150]]
-* inchi-key:
+== Reaction(s) not found ==
-** mbwxntaxlnyfjb-lkudqcmesa-n
+* [NoneRXN-17143 RXN-17143]
-* molecular-weight:
+* [NoneRXN-17148 RXN-17148]
-** 450.703
+* [NoneRXN-17142 RXN-17142]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17147 RXN-17147]
-* [[1.1.4.1-RXN]]
+* [NoneRXN-17151 RXN-17151]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17149 RXN-17149]
-* [[1.1.4.1-RXN]]
+* [NoneRXN-17146 RXN-17146]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=phylloquinone}}
+{{#set: common-name=3-hydroxyquinaldate biosynthesis}}
-{{#set: inchi-key=inchikey=mbwxntaxlnyfjb-lkudqcmesa-n}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=450.703}}
+{{#set: completion rate=0.12}}
+{{#set: nb total reaction=8}}