Difference between revisions of "PWY-7733"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] ==
+== Pathway PWY-7430 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** phylloquinone
+** indole degradation to anthranil and anthranilate
-* smiles:
+== Reaction(s) found ==
-** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
+* [[INDOLE-23-DIOXYGENASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** mbwxntaxlnyfjb-lkudqcmesa-n
+* [NoneRXN-15191 RXN-15191]
-* molecular-weight:
+* [NoneRXN-15188 RXN-15188]
-** 450.703
+* [NoneRXN-15187 RXN-15187]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-33090}}
-* [[1.1.4.1-RXN]]
+{{#set: common-name=indole degradation to anthranil and anthranilate}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[1.1.4.1-RXN]]
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=phylloquinone}}
-{{#set: inchi-key=inchikey=mbwxntaxlnyfjb-lkudqcmesa-n}}
-{{#set: molecular-weight=450.703}}