Difference between revisions of "PWY-7734"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])(...")
 
(Created page with "Category:pathway == Pathway PWY-7734 == * taxonomic-range: ** tax-2 * common-name: ** quinoxaline-2-carboxylate biosynthesis == Reaction(s) found == * RXN-17150 == Rea...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] ==
+
== Pathway PWY-7734 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** cmp
+
** quinoxaline-2-carboxylate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
+
* [[RXN-17150]]
* inchi-key:
+
== Reaction(s) not found ==
** ierhlvcpsmictf-xvfcmesisa-l
+
* [NoneRXN-17152 RXN-17152]
* molecular-weight:
+
* [NoneRXN-17154 RXN-17154]
** 321.183
+
* [NoneRXN-17148 RXN-17148]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-17147 RXN-17147]
* [[ATCM]]
+
* [NoneRXN-17145 RXN-17145]
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [NoneRXN-17153 RXN-17153]
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
+
* [NoneRXN-17149 RXN-17149]
* [[PHOSPHASERSYN-RXN]]
+
* [NoneRXN-17146 RXN-17146]
* [[RXN-11832]]
+
* [NoneRXN-17144 RXN-17144]
* [[RXN-14026]]
+
{{#set: taxonomic-range=tax-2}}
* [[RXN-5781]]
+
{{#set: common-name=quinoxaline-2-carboxylate biosynthesis}}
* [[RXN-9614]]
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.1}}
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
{{#set: nb total reaction=10}}
* [[2.7.8.11-RXN]]
 
* [[ATCY]]
 
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 
* [[DATCY]]
 
* [[DCTCP]]
 
* [[DGTCY]]
 
* [[DTTGY]]
 
* [[DUTCP]]
 
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 
* [[GTCY]]
 
* [[ITCY]]
 
* [[P-PANTOCYSLIG-RXN]]
 
* [[PHOSPHAGLYPSYN-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-12198]]
 
* [[RXN-12200]]
 
* [[RXN-17731]]
 
* [[RXN-17733]]
 
* [[RXN-5781]]
 
* [[RXN-8141]]
 
* [[RXN-9614]]
 
* [[RXN0-302]]
 
* [[RXN0-383]]
 
* [[RXN66-578]]
 
* [[UTCY]]
 
</div>
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=cmp}}
 
{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
 
{{#set: molecular-weight=321.183}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-7734

  • taxonomic-range:
    • tax-2
  • common-name:
    • quinoxaline-2-carboxylate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-17152 RXN-17152]
  • [NoneRXN-17154 RXN-17154]
  • [NoneRXN-17148 RXN-17148]
  • [NoneRXN-17147 RXN-17147]
  • [NoneRXN-17145 RXN-17145]
  • [NoneRXN-17153 RXN-17153]
  • [NoneRXN-17149 RXN-17149]
  • [NoneRXN-17146 RXN-17146]
  • [NoneRXN-17144 RXN-17144]