Difference between revisions of "PWY-7752"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15653 CPD-15653] ==
+== Pathway PWY-2881 ==
+* taxonomic-range:
+** tax-3193
 * common-name:
-** (3r)-hydroxy, 6-cis-tridecenoyl-coa
+** cytokinins 7-n-glucoside biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-4733]]
-* inchi-key:
+== Reaction(s) not found ==
-** adzjvtnixnsngu-ukoyhulusa-j
+* [NoneRXN-4731 RXN-4731]
-* molecular-weight:
+* [NoneRXN-4727 RXN-4727]
-** 973.818
+* [NoneRXN-4721 RXN-4721]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-4736 RXN-4736]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-4724 RXN-4724]
-* [[RXN-14772]]
+* [NoneRXN-4729 RXN-4729]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-3193}}
-{{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}}
+{{#set: common-name=cytokinins 7-n-glucoside biosynthesis}}
-{{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=973.818}}
+{{#set: completion rate=0.14}}
+{{#set: nb total reaction=7}}