Difference between revisions of "PWY-7752"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14424 CPD-14424] ==
+== Pathway PWY-7752 ==
+* taxonomic-range:
+** tax-7742
 * common-name:
-** (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa
+** gadusol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-9140]]
-* inchi-key:
+== Reaction(s) not found ==
-** kidydclnvxonef-pybsmvoosa-j
+* [NoneRXN-17375 RXN-17375]
-* molecular-weight:
+* [NoneRXN-17364 RXN-17364]
-** 1091.996
+{{#set: taxonomic-range=tax-7742}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=gadusol biosynthesis}}
-* [[RXN-13444]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[RXN-13443]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa}}
-{{#set: inchi-key=inchikey=kidydclnvxonef-pybsmvoosa-j}}
-{{#set: molecular-weight=1091.996}}