Difference between revisions of "PWY-7760"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA3-ISOPENTENYL-PP DELTA3-ISOPENTENYL-PP] == * common-name: ** isopentenyl diphosphate * smi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Actinorhodin-Intermediate-2 Actinorhodin-Intermediate-2] == * common-name: ** 9-hydroxy-3,5,7,1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA3-ISOPENTENYL-PP DELTA3-ISOPENTENYL-PP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Actinorhodin-Intermediate-2 Actinorhodin-Intermediate-2] ==
 
* common-name:
 
* common-name:
** isopentenyl diphosphate
+
** 9-hydroxy-3,5,7,11,13,15-hexaoxohexadecanoyl-[pks-acp]
* smiles:
 
** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
 
* inchi-key:
 
** nuhsrofqtuxzqq-uhfffaoysa-k
 
* molecular-weight:
 
** 243.069
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 
* [[FPPS]]
 
* [[FPPSYN-RXN]]
 
* [[GGPS]]
 
* [[GPPS]]
 
* [[GPPSYN-RXN]]
 
* [[IDI]]
 
* [[IPPISOM-RXN]]
 
* [[RXN-10068]]
 
* [[RXN-11486]]
 
* [[RXN-11488]]
 
* [[RXN-11963]]
 
* [[RXN-8999]]
 
* [[RXN-9969]]
 
* [[RXN0-5180]]
 
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
+
* [[RXN1A0-6303]]
* [[GPPSYN-RXN]]
 
* [[IDS1]]
 
* [[IPPISOM-RXN]]
 
* [[ISPH2-RXN]]
 
* [[RXN-10068]]
 
* [[RXN-11963]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isopentenyl diphosphate}}
+
{{#set: common-name=9-hydroxy-3,5,7,11,13,15-hexaoxohexadecanoyl-[pks-acp]}}
{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
 
{{#set: molecular-weight=243.069}}
 

Revision as of 14:19, 26 August 2019

Metabolite Actinorhodin-Intermediate-2

  • common-name:
    • 9-hydroxy-3,5,7,11,13,15-hexaoxohexadecanoyl-[pks-acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "9-hydroxy-3,5,7,11,13,15-hexaoxohexadecanoyl-[pks-acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.