Difference between revisions of "PWY-7765"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
 * common-name:
-** prostaglandin e2
+** histidinol
 * smiles:
-** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
+** c1(nc=nc=1cc(co)[n+])
 * inchi-key:
-** xeybrnlfezdvaw-arsrfyassa-m
+** zqisrdcjnbuvmm-yfkpbyrvsa-o
 * molecular-weight:
-** 351.462
+** 142.18
 == Reaction(s) known to consume the compound ==
-* [[1.1.1.141-RXN]]
+* [[HISTOLDEHYD-RXN]]
-* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+* [[RXN-8001]]
 == Reaction(s) known to produce the compound ==
-* [[1.1.1.141-RXN]]
+* [[HISTIDPHOS-RXN]]
-* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
+* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
-* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+* [[HISTOLDEHYD-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=prostaglandin e2}}
+{{#set: common-name=histidinol}}
-{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
+{{#set: inchi-key=inchikey=zqisrdcjnbuvmm-yfkpbyrvsa-o}}
-{{#set: molecular-weight=351.462}}
+{{#set: molecular-weight=142.18}}