Difference between revisions of "PWY-7766"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(...")
(Created page with "Category:pathway == Pathway PWY-7766 == * taxonomic-range: ** tax-1239 ** tax-201174 * common-name: ** heme b biosynthesis iv (gram-positive bacteria) == Reaction(s) found...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] ==
+
== Pathway PWY-7766 ==
 +
* taxonomic-range:
 +
** tax-1239
 +
** tax-201174
 
* common-name:
 
* common-name:
** o-sinapoylcholine
+
** heme b biosynthesis iv (gram-positive bacteria)
* smiles:
+
== Reaction(s) found ==
** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
+
* [[RXN-17517]]
* inchi-key:
+
* [[RXN-17518]]
** hujxhfrxwwgyqh-uhfffaoysa-o
+
* [[UROGENDECARBOX-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 310.369
+
* [NoneRXN-19755 RXN-19755]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-19756 RXN-19756]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-1239|tax-201174}}
* [[2.3.1.91-RXN]]
+
{{#set: common-name=heme b biosynthesis iv (gram-positive bacteria)}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=3}}
{{#set: common-name=o-sinapoylcholine}}
+
{{#set: completion rate=0.6}}
{{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}}
+
{{#set: nb total reaction=5}}
{{#set: molecular-weight=310.369}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7766

  • taxonomic-range:
    • tax-1239
    • tax-201174
  • common-name:
    • heme b biosynthesis iv (gram-positive bacteria)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-19755 RXN-19755]
  • [NoneRXN-19756 RXN-19756]