Difference between revisions of "PWY-7766"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-eIF5A-lysine N-4-aminobutylidene-eIF5A-lysine] == * common-name: ** an [eif...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** o-sinapoylcholine |
| + | * smiles: | ||
| + | ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c | ||
| + | * inchi-key: | ||
| + | ** hujxhfrxwwgyqh-uhfffaoysa-o | ||
| + | * molecular-weight: | ||
| + | ** 310.369 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.3.1.91-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o-sinapoylcholine}} |
| + | {{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}} | ||
| + | {{#set: molecular-weight=310.369}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite O-SINAPOYLCHOLINE
- common-name:
- o-sinapoylcholine
- smiles:
- c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
- inchi-key:
- hujxhfrxwwgyqh-uhfffaoysa-o
- molecular-weight:
- 310.369
