Difference between revisions of "PWY-7767"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o...")
(Created page with "Category:pathway == Pathway PWY-7250 == * taxonomic-range: ** tax-2759 ** tax-2 ** tax-2157 * common-name: ** [2fe-2s] iron-sulfur cluster biosynthesis == Reaction(s) foun...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Pathway PWY-7250 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 +
** tax-2157
 
* common-name:
 
* common-name:
** cyanidin
+
** [2fe-2s] iron-sulfur cluster biosynthesis
* smiles:
+
== Reaction(s) found ==
** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
+
* [[RXN-14384]]
* inchi-key:
+
* [[RXN-14385]]
** vevzsmaejfvwil-uhfffaoysa-m
+
* [[RXN-14386]]
* molecular-weight:
+
* [[RXN-14387]]
** 285.232
+
* [[RXN-15881]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[RXN-9725]]
+
* [NoneRXN-14388 RXN-14388]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-14391 RXN-14391]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-14389 RXN-14389]
{{#set: common-name=cyanidin}}
+
* [NoneRXN-14381 RXN-14381]
{{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}}
+
* [NoneRXN-14390 RXN-14390]
{{#set: molecular-weight=285.232}}
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
 +
{{#set: common-name=[2fe-2s] iron-sulfur cluster biosynthesis}}
 +
{{#set: nb reaction found=5}}
 +
{{#set: completion rate=0.5}}
 +
{{#set: nb total reaction=10}}

Revision as of 20:16, 18 December 2020

Pathway PWY-7250

  • taxonomic-range:
    • tax-2759
    • tax-2
    • tax-2157
  • common-name:
    • [2fe-2s] iron-sulfur cluster biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14388 RXN-14388]
  • [NoneRXN-14391 RXN-14391]
  • [NoneRXN-14389 RXN-14389]
  • [NoneRXN-14381 RXN-14381]
  • [NoneRXN-14390 RXN-14390]

Property "Common-name" (as page type) with input value "2fe-2s] iron-sulfur cluster biosynthesis" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.