Difference between revisions of "PWY-7779"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] ==
+== Pathway PWY-7779 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** s-sulfo-l-cysteine
+** methyl tert-butyl ether degradation
-* smiles:
+== Reaction(s) found ==
-** c(c([n+])c(=o)[o-])ss([o-])(=o)=o
+* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
-* inchi-key:
+* [[RXN-11662]]
-** nokpbjyhphhwan-reohclbhsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-17615 RXN-17615]
-** 200.204
+* [NoneRXN-17605 RXN-17605]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17612 RXN-17612]
-* [[SULFOCYS-RXN]]
+* [NoneRXN-17603 RXN-17603]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17606 RXN-17606]
-* [[SULFOCYS-RXN]]
+* [NoneRXN-17610 RXN-17610]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-17602 RXN-17602]
-{{#set: common-name=s-sulfo-l-cysteine}}
+* [NoneRXN-17613 RXN-17613]
-{{#set: inchi-key=inchikey=nokpbjyhphhwan-reohclbhsa-m}}
+{{#set: taxonomic-range=tax-2}}
-{{#set: molecular-weight=200.204}}
+{{#set: common-name=methyl tert-butyl ether degradation}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.2}}
+{{#set: nb total reaction=10}}