Difference between revisions of "PWY-7779"

Revision as of 20:16, 18 December 2020

[NoneGDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN]

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-TOLUENECARBOXYLATE 4-TOLUENECARBOXYLATE] ==
+== Pathway GDPRHAMSYN-PWY ==
+* taxonomic-range:
+** tax-1239
+** tax-1224
 * common-name:
-** 4-toluenecarboxylate
+** gdp-d-rhamnose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc1(c=cc(=cc=1)c(=o)[o-])
+* [[GDPMANDEHYDRA-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** lpnbbfkouusudb-uhfffaoysa-m
+* [NoneGDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-1224|tax-1239}}
-** 135.142
+{{#set: common-name=gdp-d-rhamnose biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[RXN-8582]]
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=4-toluenecarboxylate}}
-{{#set: inchi-key=inchikey=lpnbbfkouusudb-uhfffaoysa-m}}
-{{#set: molecular-weight=135.142}}