Difference between revisions of "PWY-7791"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+== Pathway PWY-7791 ==
+* taxonomic-range:
+** tax-201174
+** tax-1239
+** tax-2157
 * common-name:
-** (s)-3-hydroxy-(5z)-tetradecenoyl-coa
+** ump biosynthesis iii
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+* [[ASPCARBTRANS-RXN]]
-* inchi-key:
+* [[CARBPSYN-RXN]]
-** kjjpuifalmaqpf-suakzgbesa-j
+* [[DIHYDROOROT-RXN]]
-* molecular-weight:
+* [[OROPRIBTRANS-RXN]]
-** 987.845
+* [[OROTPDECARB-RXN]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-* [[RXN-14393]]
+* [NoneOROTATE-REDUCTASE-NADH-RXN OROTATE-REDUCTASE-NADH-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1239|tax-2157|tax-201174}}
-* [[RXN-14393]]
+{{#set: common-name=ump biosynthesis iii}}
-* [[RXN0-5393]]
+{{#set: nb reaction found=5}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.83}}
-{{#set: common-name=(s)-3-hydroxy-(5z)-tetradecenoyl-coa}}
+{{#set: nb total reaction=6}}
-{{#set: inchi-key=inchikey=kjjpuifalmaqpf-suakzgbesa-j}}
-{{#set: molecular-weight=987.845}}