Difference between revisions of "PWY-7803"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N1-Methylguanine-9 tRNA-Containing-N1-Methylguanine-9] ==
 * common-name:
-** protoporphyrin ix
+** an n1-methylguanine9 in trna
-* smiles:
-** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
-* inchi-key:
-** ksfovussgskxfi-ujjxfscmsa-l
-* molecular-weight:
-** 560.651
 == Reaction(s) known to consume the compound ==
-* [[PROTOHEMEFERROCHELAT-RXN]]
-* [[RXN1F-20]]
 == Reaction(s) known to produce the compound ==
-* [[PPPGO]]
+* [[RXN-12459]]
-* [[PROTOHEMEFERROCHELAT-RXN]]
-* [[PROTOPORGENOXI-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=protoporphyrin ix}}
+{{#set: common-name=an n1-methylguanine9 in trna}}
-{{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}
-{{#set: molecular-weight=560.651}}