Difference between revisions of "PWY-7807"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] ==
+== Pathway PWY-7807 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** d-myo-inositol (1,3,4)-trisphosphate
+** glyphosate degradation iii
-* smiles:
+== Reaction(s) found ==
-** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+* [[ADENPRIBOSYLTRAN-RXN]]
-* inchi-key:
+* [[INORGPYROPHOSPHAT-RXN]]
-** mmwciqzxvozegg-mlqgymepsa-h
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN0-6710 RXN0-6710]
-** 414.049
+* [NoneRXN0-1401 RXN0-1401]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17959 RXN-17959]
-* [[2.7.1.133-RXN]]
+* [NoneRXN-17958 RXN-17958]
-* [[2.7.1.139-RXN]]
+* [NoneRXN-17957 RXN-17957]
-* [[RXN-10939]]
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-10959]]
+{{#set: common-name=glyphosate degradation iii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-8730]]
+{{#set: completion rate=0.29}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=7}}
-{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
-{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
-{{#set: molecular-weight=414.049}}