Difference between revisions of "PWY-7807"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * common-name: ** d-myo-inositol (1...")
(Created page with "Category:pathway == Pathway PWY66-428 == * taxonomic-range: ** tax-40674 * common-name: ** l-threonine degradation v == Reaction(s) found == * RXN-7790 * THREDEHYD-R...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] ==
+
== Pathway PWY66-428 ==
 +
* taxonomic-range:
 +
** tax-40674
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4)-trisphosphate
+
** l-threonine degradation v
* smiles:
+
== Reaction(s) found ==
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
* [[RXN-7790]]
* inchi-key:
+
* [[THREDEHYD-RXN]]
** mmwciqzxvozegg-mlqgymepsa-h
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 414.049
+
{{#set: taxonomic-range=tax-40674}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-threonine degradation v}}
* [[2.7.1.133-RXN]]
+
{{#set: nb reaction found=2}}
* [[2.7.1.139-RXN]]
+
{{#set: completion rate=1.0}}
* [[RXN-10939]]
+
{{#set: nb total reaction=2}}
* [[RXN-10959]]
 
== Reaction(s) known to produce the compound ==
 
* [[RXN-8730]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
 
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
 
{{#set: molecular-weight=414.049}}
 

Revision as of 20:16, 18 December 2020

Pathway PWY66-428

  • taxonomic-range:
    • tax-40674
  • common-name:
    • l-threonine degradation v

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present