Difference between revisions of "PWY-7822"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2184 CPD-2184] == * common-name: ** 1-oleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol * smi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2184 CPD-2184] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol
+
** 1-oleoyl-sn-glycerol
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)occ(oc(=o)cc=ccccccccccccc)cop(=o)([o-])occ(co)o
+
** ccccccccc=ccccccccc(=o)occ(co)o
 
* inchi-key:
 
* inchi-key:
** rkuhyanozyjdlk-vzrsdkansa-m
+
** rzrnayuhwvfmip-qjrazlaksa-n
 
* molecular-weight:
 
* molecular-weight:
** 745.992
+
** 356.545
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15089]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1725]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol}}
+
{{#set: common-name=1-oleoyl-sn-glycerol}}
{{#set: inchi-key=inchikey=rkuhyanozyjdlk-vzrsdkansa-m}}
+
{{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}}
{{#set: molecular-weight=745.992}}
+
{{#set: molecular-weight=356.545}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-11690

  • common-name:
    • 1-oleoyl-sn-glycerol
  • smiles:
    • ccccccccc=ccccccccc(=o)occ(co)o
  • inchi-key:
    • rzrnayuhwvfmip-qjrazlaksa-n
  • molecular-weight:
    • 356.545

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality