Difference between revisions of "PWY-7822"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] ==
+== Pathway PWY-7822 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 1-oleoyl-sn-glycerol
+** chitin degradation iii (serratia)
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccccccccc(=o)occ(co)o
+* [[3.2.1.14-RXN]]
-* inchi-key:
+* [[RXN-12625]]
-** rzrnayuhwvfmip-qjrazlaksa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-18084 RXN-18084]
-** 356.545
+* [NoneRXN-18080 RXN-18080]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18083 RXN-18083]
-* [[RXN-15089]]
+* [NoneRXN-12309 RXN-12309]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-18079 RXN-18079]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=1-oleoyl-sn-glycerol}}
+{{#set: common-name=chitin degradation iii (serratia)}}
-{{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}}
+{{#set: nb reaction found=2}}
-{{#set: molecular-weight=356.545}}
+{{#set: completion rate=0.29}}
+{{#set: nb total reaction=7}}