Difference between revisions of "PWY-7839"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-AMINOACRYLATE 2-AMINOACRYLATE] == * common-name: ** 2-aminoprop-2-enoate * smiles: ** c=c([n+...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-AMINOACRYLATE 2-AMINOACRYLATE] ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z)-octadecenoyl-coa
+
** 2-aminoprop-2-enoate
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c=c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ourowzutgfhrje-saiinbspsa-j
+
** uqbojoootlpnst-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 87.078
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17787]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17786]]
+
* [[RXN-15125]]
 +
* [[RXN-15128]]
 +
* [[RXN-15129]]
 +
* [[RXN-15137]]
 +
* [[RXN-15581]]
 +
* [[RXN-15582]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
+
{{#set: common-name=2-aminoprop-2-enoate}}
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
+
{{#set: inchi-key=inchikey=uqbojoootlpnst-uhfffaoysa-n}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=87.078}}

Revision as of 14:18, 26 August 2019

Metabolite 2-AMINOACRYLATE

  • common-name:
    • 2-aminoprop-2-enoate
  • smiles:
    • c=c([n+])c(=o)[o-]
  • inchi-key:
    • uqbojoootlpnst-uhfffaoysa-n
  • molecular-weight:
    • 87.078

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality