Difference between revisions of "PWY-7840"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] ==
+== Pathway PWY-7840 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** 5-methyl-3-oxo-4-hexenoyl-coa
+** gala-series glycosphingolipids biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-18301]]
-* inchi-key:
+* [[RXN-18302]]
-** zfkzvsujtdsjey-svhodsnwsa-j
+* [[RXN-18303]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 887.641
+* [None2.4.1.47-RXN 2.4.1.47-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18291 RXN-18291]
-* [[RXN-11921]]
+{{#set: taxonomic-range=tax-33208}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=gala-series glycosphingolipids biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=3}}
-{{#set: common-name=5-methyl-3-oxo-4-hexenoyl-coa}}
+{{#set: completion rate=0.6}}
-{{#set: inchi-key=inchikey=zfkzvsujtdsjey-svhodsnwsa-j}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=887.641}}