Difference between revisions of "PWY-7845"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] ==
+== Pathway PWY-6853 ==
+* taxonomic-range:
+** tax-2
+** tax-4751
 * common-name:
-** shikimate
+** ethylene biosynthesis ii (microbes)
-* smiles:
+== Reaction(s) found ==
-** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-])
+* [[RXN-14116]]
-* inchi-key:
+== Reaction(s) not found ==
-** jxohggnkmltubp-hsuxutppsa-m
+* [NoneRXN-12536 RXN-12536]
-* molecular-weight:
+* [NoneSPONTPRO-RXN SPONTPRO-RXN]
-** 173.145
+* [NoneRXN-14542 RXN-14542]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12538 RXN-12538]
-* [[RXN-7968]]
+{{#set: taxonomic-range=tax-2|tax-4751}}
-* [[SHIKIMATE-KINASE-RXN]]
+{{#set: common-name=ethylene biosynthesis ii (microbes)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+{{#set: completion rate=0.2}}
-* [[SHIKIMATE-KINASE-RXN]]
+{{#set: nb total reaction=5}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=shikimate}}
-{{#set: inchi-key=inchikey=jxohggnkmltubp-hsuxutppsa-m}}
-{{#set: molecular-weight=173.145}}