Difference between revisions of "PWY-7845"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12279 CPD-12279] == * common-name: ** 2-iminoacetate * smiles: ** c(=o)([o-])c=n * inchi-ke...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] == * common-name: ** butanoyl-coa * smiles: ** cccc(=o)sccnc(=o)ccnc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12279 CPD-12279] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] ==
 
* common-name:
 
* common-name:
** 2-iminoacetate
+
** butanoyl-coa
 
* smiles:
 
* smiles:
** c(=o)([o-])c=n
+
** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** tvmuhoaonwhjbv-uhfffaoysa-m
+
** crfngmnykdxrtn-hdrjhvaisa-j
 
* molecular-weight:
 
* molecular-weight:
** 72.043
+
** 833.593
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THIAZOLSYN2-RXN]]
+
* [[ACACT2h]]
 +
* [[ACOA40OR]]
 +
* [[ACOAD1f]]
 +
* [[RXN-12565]]
 +
* [[RXN-13029]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11319]]
+
* [[ACOAD1f]]
* [[RXN-12614]]
+
* [[ACOAR1h]]
 +
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-12558]]
 +
* [[RXN-13029]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-iminoacetate}}
+
{{#set: common-name=butanoyl-coa}}
{{#set: inchi-key=inchikey=tvmuhoaonwhjbv-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}}
{{#set: molecular-weight=72.043}}
+
{{#set: molecular-weight=833.593}}

Revision as of 14:19, 26 August 2019

Metabolite BUTYRYL-COA

  • common-name:
    • butanoyl-coa
  • smiles:
    • cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • crfngmnykdxrtn-hdrjhvaisa-j
  • molecular-weight:
    • 833.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality