Difference between revisions of "PWY-7853"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8089 CPD-8089] == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * smi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Persulfurated-L-cysteine-desulfurases Persulfurated-L-cysteine-desulfurases] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8089 CPD-8089] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Persulfurated-L-cysteine-desulfurases Persulfurated-L-cysteine-desulfurases] ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine
+
** an s-sulfanyl-[l-cysteine desulfurase]
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** lpdgucimnbnwej-bxzvqshesa-n
 
* molecular-weight:
 
** 782.092
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8330]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8321]]
+
* [[RXN-15881]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=an s-sulfanyl-[l-cysteine desulfurase]}}
{{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}}
 
{{#set: molecular-weight=782.092}}
 

Revision as of 14:18, 26 August 2019

Metabolite Persulfurated-L-cysteine-desulfurases

  • common-name:
    • an s-sulfanyl-[l-cysteine desulfurase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an s-sulfanyl-[l-cysteine desulfurase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.