Difference between revisions of "PWY-7856"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-381 CPD-381] == * common-name: ** (s)-2-hydroxyglutarate * smiles: ** c(=o)([o-])c(o)ccc(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3 CPD-3] == * common-name: ** molybdate * smiles: ** [mo](=o)(=o)([o-])[o-] * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-381 CPD-381] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3 CPD-3] ==
 
* common-name:
 
* common-name:
** (s)-2-hydroxyglutarate
+
** molybdate
 
* smiles:
 
* smiles:
** c(=o)([o-])c(o)ccc(=o)[o-]
+
** [mo](=o)(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hwxbtnavrsuojr-vkhmyheasa-l
+
** mefbjemvzonfcj-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 146.099
+
** 159.938
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
+
* [[ExchangeSeed-CPD-3]]
* [[RXN-16701]]
+
* [[RXN-8348]]
 +
* [[TransportSeed-CPD-3]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
+
* [[ExchangeSeed-CPD-3]]
* [[RXN-16701]]
+
* [[TransportSeed-CPD-3]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2-hydroxyglutarate}}
+
{{#set: common-name=molybdate}}
{{#set: inchi-key=inchikey=hwxbtnavrsuojr-vkhmyheasa-l}}
+
{{#set: inchi-key=inchikey=mefbjemvzonfcj-uhfffaoysa-n}}
{{#set: molecular-weight=146.099}}
+
{{#set: molecular-weight=159.938}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-3

  • common-name:
    • molybdate
  • smiles:
    • [mo](=o)(=o)([o-])[o-]
  • inchi-key:
    • mefbjemvzonfcj-uhfffaoysa-n
  • molecular-weight:
    • 159.938

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality