Difference between revisions of "PWY-7858"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc...")
 
(Created page with "Category:pathway == Pathway PWY-7858 == * taxonomic-range: ** tax-2 * common-name: ** (5z)-dodec-5-enoate biosynthesis ii == Reaction(s) found == * RXN0-2141 * RXN0-...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
+
== Pathway PWY-7858 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 3,3',5-triiodothyroacetate
+
** (5z)-dodec-5-enoate biosynthesis ii
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
+
* [[RXN0-2141]]
* inchi-key:
+
* [[RXN0-2142]]
** uowzuvnaguaeqc-uhfffaoysa-m
+
* [[RXN0-2144]]
* molecular-weight:
+
* [[RXN0-2145]]
** 620.928
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [None5.3.3.14-RXN 5.3.3.14-RXN]
* [[RXN-10618]]
+
* [NoneRXN-18461 RXN-18461]
* [[RXN-10619]]
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=(5z)-dodec-5-enoate biosynthesis ii}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=4}}
{{#set: common-name=3,3',5-triiodothyroacetate}}
+
{{#set: completion rate=0.67}}
{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
+
{{#set: nb total reaction=6}}
{{#set: molecular-weight=620.928}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7858

  • taxonomic-range:
    • tax-2
  • common-name:
    • (5z)-dodec-5-enoate biosynthesis ii

Reaction(s) found

Reaction(s) not found

  • [None5.3.3.14-RXN 5.3.3.14-RXN]
  • [NoneRXN-18461 RXN-18461]