Difference between revisions of "PWY-7858"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * common-name: ** 9(s)-hpote * smiles: ** ccc=ccc=cc=cc(cccccccc([o-])=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-N7-methylguanine-2069 23S-rRNA-N7-methylguanine-2069] == * common-name: ** an n7-methy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-N7-methylguanine-2069 23S-rRNA-N7-methylguanine-2069] ==
 
* common-name:
 
* common-name:
** 9(s)-hpote
+
** an n7-methylguanine2069 in 23s rrna
* smiles:
 
** ccc=ccc=cc=cc(cccccccc([o-])=o)oo
 
* inchi-key:
 
** rwkjtihnysiihw-mebvtjqtsa-m
 
* molecular-weight:
 
** 309.425
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8497]]
+
* [[RXN0-6950]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9(s)-hpote}}
+
{{#set: common-name=an n7-methylguanine2069 in 23s rrna}}
{{#set: inchi-key=inchikey=rwkjtihnysiihw-mebvtjqtsa-m}}
 
{{#set: molecular-weight=309.425}}
 

Revision as of 09:22, 27 August 2019

Metabolite 23S-rRNA-N7-methylguanine-2069

  • common-name:
    • an n7-methylguanine2069 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality