Difference between revisions of "PWY-7863"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] ==
+== Pathway PWY-6605 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
 * common-name:
-** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa
+** adenine and adenosine salvage ii
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[ADENPRIBOSYLTRAN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** pcgphlmaazkqfq-fpxdaddusa-j
+* [NoneADENOSINE-NUCLEOSIDASE-RXN ADENOSINE-NUCLEOSIDASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2759}}
-** 1065.958
+{{#set: common-name=adenine and adenosine salvage ii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-16021]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-16020]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa}}
-{{#set: inchi-key=inchikey=pcgphlmaazkqfq-fpxdaddusa-j}}
-{{#set: molecular-weight=1065.958}}