Difference between revisions of "PWY-7870"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] ==
+== Pathway PWY-7870 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** &gamma;-l-glutamyl-l-cysteine
+** l-cysteine biosynthesis vii
-* smiles:
+== Reaction(s) found ==
-** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
+* [[SERINE-O-ACETTRAN-RXN]]
-* inchi-key:
+* [[SULFOCYS-RXN]]
-** ritkhvbhsgluln-whfbiakzsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-18586 RXN-18586]
-** 249.261
+* [NonePRODISULFREDUCT-A-RXN PRODISULFREDUCT-A-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[GLUTATHIONE-SYN-RXN]]
+{{#set: common-name=l-cysteine biosynthesis vii}}
-* [[RXN-14430]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[GLUTCYSLIG-RXN]]
+{{#set: nb total reaction=4}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=&gamma;-l-glutamyl-l-cysteine}}
-{{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}}
-{{#set: molecular-weight=249.261}}