Difference between revisions of "PWY-7886"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+...")
(Created page with "Category:pathway == Pathway PWY-7886 == * taxonomic-range: ** tax-2 * common-name: ** cell-surface glycoconjugate-linked phosphocholine biosynthesis == Reaction(s) found =...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] ==
+
== Pathway PWY-7886 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** l-ornithine
+
** cell-surface glycoconjugate-linked phosphocholine biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c([n+])ccc[n+]
+
* [[2.7.7.15-RXN]]
* inchi-key:
+
* [[CHOLINE-KINASE-RXN]]
** ahlphdhhmvztml-bypyzucnsa-o
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-18687 RXN-18687]
** 133.17
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=cell-surface glycoconjugate-linked phosphocholine biosynthesis}}
* [[ACETYLORNDEACET-RXN]]
+
{{#set: nb reaction found=2}}
* [[ARGINASE-RXN]]
+
{{#set: completion rate=0.67}}
* [[ORDC]]
+
{{#set: nb total reaction=3}}
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[ORNDECARBOX-RXN]]
 
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
* [[RXN-13482]]
 
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
* [[ACETYLORNDEACET-RXN]]
 
* [[AODAA]]
 
* [[ARGINASE-RXN]]
 
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
* [[RXN-13482]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=l-ornithine}}
 
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
 
{{#set: molecular-weight=133.17}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7886

  • taxonomic-range:
    • tax-2
  • common-name:
    • cell-surface glycoconjugate-linked phosphocholine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-18687 RXN-18687]