Difference between revisions of "PWY-7886"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] ==
 +
* common-name:
 +
** l-ornithine
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** c(=o)([o-])c([n+])ccc[n+]
* common-name:
+
* inchi-key:
** chlorophyllide a
+
** ahlphdhhmvztml-bypyzucnsa-o
 
* molecular-weight:
 
* molecular-weight:
** 612.967
+
** 133.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13398]]
+
* [[ACETYLORNDEACET-RXN]]
* [[RXN-7663]]
+
* [[ARGINASE-RXN]]
* [[RXN-7676]]
+
* [[ORDC]]
* [[RXN1F-66]]
+
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5286]]
+
* [[ACETYLORNDEACET-RXN]]
* [[RXN1F-10]]
+
* [[AODAA]]
* [[RXN1F-66]]
+
* [[ARGINASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=chlorophyllide a}}
+
{{#set: common-name=l-ornithine}}
{{#set: molecular-weight=612.967}}
+
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
 +
{{#set: molecular-weight=133.17}}

Revision as of 14:19, 26 August 2019