Difference between revisions of "PWY-7886"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] ==
 * common-name:
-** l-ornithine
+** 5-aminolevulinate
 * smiles:
-** c(=o)([o-])c([n+])ccc[n+]
+** c(c(c[n+])=o)cc([o-])=o
 * inchi-key:
-** ahlphdhhmvztml-bypyzucnsa-o
+** zgxjtsgniosylo-uhfffaoysa-n
 * molecular-weight:
-** 133.17
+** 131.131
 == Reaction(s) known to consume the compound ==
-* [[ACETYLORNDEACET-RXN]]
+* [[PORPHOBILSYNTH-RXN]]
-* [[ARGINASE-RXN]]
-* [[ORDC]]
-* [[ORNCARBAMTRANSFER-RXN]]
-* [[ORNDECARBOX-RXN]]
-* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
-* [[ORNITHINE-CYCLODEAMINASE-RXN]]
-* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
-* [[RXN-13482]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[ACETYLORNDEACET-RXN]]
+* [[GSAAMINOTRANS-RXN]]
-* [[AODAA]]
-* [[ARGINASE-RXN]]
-* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
-* [[ORNCARBAMTRANSFER-RXN]]
-* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
-* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
-* [[RXN-13482]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-ornithine}}
+{{#set: common-name=5-aminolevulinate}}
-{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
+{{#set: inchi-key=inchikey=zgxjtsgniosylo-uhfffaoysa-n}}
-{{#set: molecular-weight=133.17}}
+{{#set: molecular-weight=131.131}}