Difference between revisions of "PWY-7888"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] ==
+== Pathway PWY-7888 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** datp
+** trna-uridine 2-thiolation (cytoplasmic)
-* smiles:
+== Reaction(s) found ==
-** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
+* [[RXN-12461]]
-* inchi-key:
+* [[RXN0-308]]
-** suyvubyjarfzho-rrkcrqdmsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-18700 RXN-18700]
-** 487.152
+* [NoneRXN-18705 RXN-18705]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18701 RXN-18701]
-* [[DATCY]]
+* [NoneRXN-18704 RXN-18704]
-* [[DATPtm]]
+* [NoneRXN-18699 RXN-18699]
-* [[DATUP]]
+{{#set: taxonomic-range=tax-2759}}
-* [[RXN-14195]]
+{{#set: common-name=trna-uridine 2-thiolation (cytoplasmic)}}
-* [[RXN-14214]]
+{{#set: nb reaction found=2}}
-* [[RXN0-384]]
+{{#set: completion rate=0.29}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=7}}
-* [[DADPKIN-RXN]]
-* [[DATPtm]]
-* [[NDPK]]
-* [[NDPKm]]
-* [[RXN-14192]]
-* [[RXN0-745]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=datp}}
-{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
-{{#set: molecular-weight=487.152}}