Difference between revisions of "PWY-7889"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hepta-oxo-hexadecanoyl-ACPs Hepta-oxo-hexadecanoyl-ACPs] == * common-name: ** a 3,5,7,9,11,13,1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3705 CPD-3705] == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3705 CPD-3705] == |
* common-name: | * common-name: | ||
| − | ** | + | ** adenosine 2'-monophosphate |
| + | * smiles: | ||
| + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o | ||
| + | * inchi-key: | ||
| + | ** qdfhpfsbqfllsw-kqynxxcusa-l | ||
| + | * molecular-weight: | ||
| + | ** 345.208 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12057]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adenosine 2'-monophosphate}} |
| + | {{#set: inchi-key=inchikey=qdfhpfsbqfllsw-kqynxxcusa-l}} | ||
| + | {{#set: molecular-weight=345.208}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-3705
- common-name:
- adenosine 2'-monophosphate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o
- inchi-key:
- qdfhpfsbqfllsw-kqynxxcusa-l
- molecular-weight:
- 345.208
