Difference between revisions of "PWY-7892"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-k...") |
(Created page with "Category:pathway == Pathway PWY-7892 == * taxonomic-range: ** tax-2 * common-name: ** trna-uridine 2-thiolation (bacteria) == Reaction(s) found == * RXN0-2023 * RXN0...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:pathway]] |
| − | == | + | == Pathway PWY-7892 == |
| + | * taxonomic-range: | ||
| + | ** tax-2 | ||
* common-name: | * common-name: | ||
| − | ** | + | ** trna-uridine 2-thiolation (bacteria) |
| − | + | == Reaction(s) found == | |
| − | + | * [[RXN0-2023]] | |
| − | + | * [[RXN0-308]] | |
| − | + | * [[RXN0-5144]] | |
| − | + | == Reaction(s) not found == | |
| − | + | * [NoneRXN-18708 RXN-18708] | |
| − | == Reaction(s) | + | * [NoneRXN0-7081 RXN0-7081] |
| − | * [[ | + | * [NoneRXN-18709 RXN-18709] |
| − | * [[ | + | * [NoneRXN-18707 RXN-18707] |
| − | * [[ | + | * [NoneRXN-20756 RXN-20756] |
| − | * [ | + | * [NoneRXN-20755 RXN-20755] |
| − | + | * [NoneRXN-20757 RXN-20757] | |
| − | * [ | + | * [NoneRXN-18710 RXN-18710] |
| − | * [ | + | {{#set: taxonomic-range=tax-2}} |
| − | * [ | + | {{#set: common-name=trna-uridine 2-thiolation (bacteria)}} |
| − | * [ | + | {{#set: nb reaction found=3}} |
| − | + | {{#set: completion rate=0.27}} | |
| − | + | {{#set: nb total reaction=11}} | |
| − | * [ | ||
| − | * [ | ||
| − | * [ | ||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 10:58, 18 March 2021
Pathway PWY-7892
- taxonomic-range:
- tax-2
- common-name:
- trna-uridine 2-thiolation (bacteria)
Reaction(s) found
Reaction(s) not found
- [NoneRXN-18708 RXN-18708]
- [NoneRXN0-7081 RXN0-7081]
- [NoneRXN-18709 RXN-18709]
- [NoneRXN-18707 RXN-18707]
- [NoneRXN-20756 RXN-20756]
- [NoneRXN-20755 RXN-20755]
- [NoneRXN-20757 RXN-20757]
- [NoneRXN-18710 RXN-18710]
