Difference between revisions of "PWY-7892"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-k...") |
(Created page with "Category:pathway == Pathway PWY-6788 == * taxonomic-range: ** tax-4751 * common-name: ** cellulose degradation ii (fungi) == Reaction(s) found == * 3.2.1.91-RXN * RX...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:pathway]] |
| − | == | + | == Pathway PWY-6788 == |
| + | * taxonomic-range: | ||
| + | ** tax-4751 | ||
* common-name: | * common-name: | ||
| − | ** | + | ** cellulose degradation ii (fungi) |
| − | + | == Reaction(s) found == | |
| − | + | * [[3.2.1.91-RXN]] | |
| − | + | * [[RXN-10773]] | |
| − | + | * [[RXN-2043]] | |
| − | + | == Reaction(s) not found == | |
| − | + | All reactions of this pathways are in present | |
| − | == Reaction(s) | + | {{#set: taxonomic-range=tax-4751}} |
| − | * [[ | + | {{#set: common-name=cellulose degradation ii (fungi)}} |
| − | + | {{#set: nb reaction found=3}} | |
| − | + | {{#set: completion rate=1.0}} | |
| − | + | {{#set: nb total reaction=3}} | |
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | == Reaction(s) | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | = | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:17, 18 December 2020
Pathway PWY-6788
- taxonomic-range:
- tax-4751
- common-name:
- cellulose degradation ii (fungi)
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present
