Difference between revisions of "PWY-7902"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15362 CPD-15362] ==
+== Pathway PWY-7902 ==
+* taxonomic-range:
+** tax-1117
 * common-name:
-** (2e,11z)-icosa-2,11-dienoyl-coa
+** glucosylglycerol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[GLYC3PDEHYDROGBIOSYN-RXN]]
-* inchi-key:
+* [[PHOSPHOGLUCMUT-RXN]]
-** laeceuxzoonxdy-nwgwhigpsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [None3.1.3.69-RXN 3.1.3.69-RXN]
-** 1053.99
+* [None2.4.1.213-RXN 2.4.1.213-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneGLUC1PADENYLTRANS-RXN GLUC1PADENYLTRANS-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1117}}
-* [[RXN-14485]]
+{{#set: common-name=glucosylglycerol biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
+{{#set: completion rate=0.4}}
-{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=1053.99}}