Difference between revisions of "PWY-7902"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15362 CPD-15362] ==
+== Pathway ETOH-ACETYLCOA-ANA-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (2e,11z)-icosa-2,11-dienoyl-coa
+** ethanol degradation i
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[ALCOHOL-DEHYDROG-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** laeceuxzoonxdy-nwgwhigpsa-j
+* [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 1053.99
+{{#set: common-name=ethanol degradation i}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[RXN-14485]]
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
-{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
-{{#set: molecular-weight=1053.99}}