Difference between revisions of "PWY-7904"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+== Pathway PWY-7904 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** n-acetyl-serotonin sulfate
+** trna-uridine 2-thiolation (thermophilic bacteria)
-* smiles:
+== Reaction(s) found ==
-** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
+* [[RXN0-308]]
-* inchi-key:
+== Reaction(s) not found ==
-** ucajznvfrvluls-uhfffaoysa-m
+* [NoneRXN-18457 RXN-18457]
-* molecular-weight:
+* [NoneRXN-18770 RXN-18770]
-** 297.305
+* [NoneRXN-18455 RXN-18455]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18456 RXN-18456]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157}}
-* [[RXN-11059]]
+{{#set: common-name=trna-uridine 2-thiolation (thermophilic bacteria)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=n-acetyl-serotonin sulfate}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=297.305}}