Difference between revisions of "PWY-7904"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-uridine746 23S-rRNA-uridine746] == * common-name: ** uridine746 in 23s rrna == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-uridine746 23S-rRNA-uridine746] ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin sulfate
+
** uridine746 in 23s rrna
* smiles:
 
** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
 
* inchi-key:
 
** ucajznvfrvluls-uhfffaoysa-m
 
* molecular-weight:
 
** 297.305
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11843]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11059]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin sulfate}}
+
{{#set: common-name=uridine746 in 23s rrna}}
{{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}}
 
{{#set: molecular-weight=297.305}}
 

Revision as of 09:22, 27 August 2019

Metabolite 23S-rRNA-uridine746

  • common-name:
    • uridine746 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality